![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/hand.right.gif){kind=icon}
This first public dataset (2024-06, doi:10.25927/0ppk7-znk14) from the CHAPTER project is described under a data set landing page.
The web page you are seeing is intended for exploration of the data structure, and anonymous https download at scales where feasible. When it is offline or too slow, we recommend to access the data set landing page and use GLOBUS from there.
The dataset is accessible via the listing below under CC-BY 4.0 LICENSE. You acknowledge our LICENSING TERMS AND CONDITIONS by downloading.
Clearly, you can download recursively - but take care to not follow parent-directory links. One working example, using a tool common on Linux distributions, would be:
wget -l 1 -r https://chapter.rdm.lab.lrz.de/1981/1981010100/ .
Legal site information: please see bottom of page.
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| 1981/ | 2024-07-24 15:25 | - | |
| 1982/ | 2024-07-24 15:36 | - | |
| 1983/ | 2024-07-24 15:46 | - | |
| 1984/ | 2024-07-24 15:57 | - | |
| 1985/ | 2024-07-24 16:08 | - | |
| 1986/ | 2024-07-24 16:18 | - | |
| 1987/ | 2024-07-24 16:29 | - | |
| 1988/ | 2024-07-24 16:40 | - | |
| 1989/ | 2024-07-24 16:50 | - | |
| 1990/ | 2024-07-24 17:01 | - | |
| 1991/ | 2024-07-24 17:12 | - | |
| 1992/ | 2024-07-24 17:23 | - | |
| 1993/ | 2024-07-24 17:33 | - | |
| 1994/ | 2024-07-24 17:44 | - | |
| 1995/ | 2024-07-24 17:54 | - | |
| 1996/ | 2024-07-24 18:05 | - | |
| 1997/ | 2024-07-24 18:15 | - | |
| 1998/ | 2024-07-24 18:26 | - | |
| 1999/ | 2024-07-24 18:36 | - | |
| 2000/ | 2024-07-24 18:47 | - | |
| 2001/ | 2024-07-24 18:57 | - | |
| 2002/ | 2024-07-24 19:08 | - | |
| 2003/ | 2024-07-24 19:19 | - | |
| 2004/ | 2024-07-24 19:29 | - | |
| 2005/ | 2024-07-24 19:40 | - | |
| 2006/ | 2024-07-24 19:50 | - | |
| 2007/ | 2024-07-24 20:01 | - | |
| 2008/ | 2024-07-24 20:12 | - | |
| 2009/ | 2024-07-24 20:22 | - | |
| 2010/ | 2024-07-24 20:33 | - | |
| 2011/ | 2024-07-24 20:43 | - | |
| 2012/ | 2024-07-24 20:54 | - | |
| 2013/ | 2024-07-24 21:05 | - | |
| 2014/ | 2024-07-24 21:15 | - | |
| 2015/ | 2024-07-24 21:26 | - | |
| 2016/ | 2024-07-24 21:36 | - | |
| 2017/ | 2024-07-24 21:47 | - | |
| 2018/ | 2024-07-24 21:58 | - | |
| 2019/ | 2024-07-24 22:09 | - | |
| 2020/ | 2024-07-24 22:19 | - | |
| 2021/ | 2024-07-24 22:30 | - | |
| 2022/ | 2024-07-24 22:41 | - | |
| Footer.html | 2024-07-26 18:23 | 494 | |
| Header.html | 2024-07-26 18:42 | 1.2K | |
| LICENSE-README | 2024-07-24 22:41 | 15K | |